C23H23F3O8S2 — CID 132526785
[(4aR,6S,7R,8S,8aS)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 132526785) has the molecular formula C23H23F3O8S2 and a molecular weight of 548.56 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aS)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(4aR,6S,7R,8S,8aS)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 132526785 |
| Molecular Formula | C23H23F3O8S2 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | [(4aR,6S,7R,8S,8aS)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]2OC(c3ccccc3)OC[C@H]2O[C@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C23H23F3O8S2/c1-13-8-10-16(11-9-13)35-22-20(31-14(2)27)19(34-36(28,29)23(24,25)26)18-17(32-22)12-30-21(33-18)15-6-4-3-5-7-15/h3-11,17-22H,12H2,1-2H3/t17-,18+,19+,20-,21?,22+/m1/s1 |
| InChIKey | CLXBWVUHBRPXRA-WCCKZFLQSA-N |
| XLogP | 4.09 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|