C24H24Cl3NO7S — CID 102047247
[(4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 102047247) has the molecular formula C24H24Cl3NO7S and a molecular weight of 576.88 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 102047247 |
| Molecular Formula | C24H24Cl3NO7S |
| Molecular Weight | 576.88 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | [(4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](NC(=O)OCC(Cl)(Cl)Cl)[C@H](Sc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C24H24Cl3NO7S/c1-14(29)33-20-18(28-23(30)32-13-24(25,26)27)22(36-16-10-6-3-7-11-16)34-17-12-31-21(35-19(17)20)15-8-4-2-5-9-15/h2-11,17-22H,12-13H2,1H3,(H,28,30)/t17-,18-,19-,20-,21?,22+/m1/s1 |
| InChIKey | UVSIMILZIIWTRO-NVZUTRPHSA-N |
| XLogP | 5.01 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|