C17H20Cl3NO7 — CID 118437041
2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 118437041) has the molecular formula C17H20Cl3NO7 and a molecular weight of 456.71 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 118437041 |
| Molecular Formula | C17H20Cl3NO7 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H20Cl3NO7/c1-24-15-11(21-16(23)26-8-17(18,19)20)12(22)13-10(27-15)7-25-14(28-13)9-5-3-2-4-6-9/h2-6,10-15,22H,7-8H2,1H3,(H,21,23)/t10-,11-,12-,13-,14?,15+/m1/s1 |
| InChIKey | JYPZOZBAHOSICP-BWTKQZKTSA-N |
| XLogP | 2.30 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|