C16H18Cl3NO6 — CID 102419427
N-[(4aR,6R,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide (PubChem CID 102419427) has the molecular formula C16H18Cl3NO6 and a molecular weight of 426.68 g/mol. Its IUPAC name is N-[(4aR,6R,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(4aR,6R,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 102419427 |
| Molecular Formula | C16H18Cl3NO6 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | N-[(4aR,6R,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide |
| SMILES | CO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](O)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl3NO6/c1-23-14-10(20-15(22)16(17,18)19)11(21)12-9(25-14)7-24-13(26-12)8-5-3-2-4-6-8/h2-6,9-14,21H,7H2,1H3,(H,20,22)/t9-,10-,11-,12-,13?,14-/m1/s1 |
| InChIKey | DZOXTHFVJDRREM-ZZOOZXLSSA-N |
| XLogP | 1.69 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|