C22H22F3NO6 — CID 175533594
N-[(4aR,6R,7R,8R,8aR)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide (PubChem CID 175533594) has the molecular formula C22H22F3NO6 and a molecular weight of 453.41 g/mol. Its IUPAC name is N-[(4aR,6R,7R,8R,8aR)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4aR,6R,7R,8R,8aR)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 175533594 |
| Molecular Formula | C22H22F3NO6 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[(4aR,6R,7R,8R,8aR)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@H]1[C@H](OCc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@@H]1O)C(F)(F)F |
| InChI | InChI=1S/C22H22F3NO6/c23-22(24,25)21(28)26-16-17(27)18-15(12-30-19(32-18)14-9-5-2-6-10-14)31-20(16)29-11-13-7-3-1-4-8-13/h1-10,15-20,27H,11-12H2,(H,26,28)/t15-,16-,17-,18+,19?,20-/m1/s1 |
| InChIKey | CDEKZVXOEDVJFD-UMIGRBLXSA-N |
| XLogP | 2.45 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |