C29H29NO6 — CID 101164891
(E)-N-[(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-phenylprop-2-enamide (PubChem CID 101164891) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is (E)-N-[(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 101164891 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (E)-N-[(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@H]1[C@@H](OCc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C29H29NO6/c31-24(17-16-20-10-4-1-5-11-20)30-25-26(32)27-23(19-34-28(36-27)22-14-8-3-9-15-22)35-29(25)33-18-21-12-6-2-7-13-21/h1-17,23,25-29,32H,18-19H2,(H,30,31)/b17-16+/t23-,25-,26+,27-,28-,29+/m1/s1 |
| InChIKey | SLSGIMCKTJCKDR-RYCUPVNQSA-N |
| XLogP | 3.60 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|