C22H28Cl3NO8 — CID 139261188
methyl 6-[[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate (PubChem CID 139261188) has the molecular formula C22H28Cl3NO8 and a molecular weight of 540.82 g/mol. Its IUPAC name is methyl 6-[[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate.
| Compound Name | methyl 6-[[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate |
|---|---|
| PubChem CID | 139261188 |
| Molecular Formula | C22H28Cl3NO8 |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | methyl 6-[[(2R,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate |
| SMILES | COC(=O)CCCCCO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H28Cl3NO8/c1-30-15(27)10-6-3-7-11-31-20-16(26-21(29)22(23,24)25)17(28)18-14(33-20)12-32-19(34-18)13-8-4-2-5-9-13/h2,4-5,8-9,14,16-20,28H,3,6-7,10-12H2,1H3,(H,26,29)/t14-,16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | HXTZLAIVGJBXHF-CKOOPXGMSA-N |
| XLogP | 2.79 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|