C24H33NO9 — CID 640146
methyl 6-[[(2S,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate (PubChem CID 640146) has the molecular formula C24H33NO9 and a molecular weight of 479.53 g/mol. Its IUPAC name is methyl 6-[[(2S,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate.
| Compound Name | methyl 6-[[(2S,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate |
|---|---|
| PubChem CID | 640146 |
| Molecular Formula | C24H33NO9 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | methyl 6-[[(2S,4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate |
| SMILES | C=CCOC(=O)N[C@H]1[C@H](OCCCCCC(=O)OC)O[C@@H]2CO[C@H](c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C24H33NO9/c1-3-13-31-24(28)25-19-20(27)21-17(15-32-22(34-21)16-10-6-4-7-11-16)33-23(19)30-14-9-5-8-12-18(26)29-2/h3-4,6-7,10-11,17,19-23,27H,1,5,8-9,12-15H2,2H3,(H,25,28)/t17-,19-,20-,21-,22+,23-/m1/s1 |
| InChIKey | OWKMIONADZNFQP-NDRNKPEZSA-N |
| XLogP | 2.22 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|