C25H35NO11S — CID 22298266
methyl 6-[[8-methylsulfonyloxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate (PubChem CID 22298266) has the molecular formula C25H35NO11S and a molecular weight of 557.62 g/mol. Its IUPAC name is methyl 6-[[8-methylsulfonyloxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate.
| Compound Name | methyl 6-[[8-methylsulfonyloxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate |
|---|---|
| PubChem CID | 22298266 |
| Molecular Formula | C25H35NO11S |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | methyl 6-[[8-methylsulfonyloxy-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexanoate |
| SMILES | C=CCOC(=O)NC1C(OCCCCCC(=O)OC)OC2COC(c3ccccc3)OC2C1OS(C)(=O)=O |
| InChI | InChI=1S/C25H35NO11S/c1-4-14-33-25(28)26-20-22(37-38(3,29)30)21-18(16-34-23(36-21)17-11-7-5-8-12-17)35-24(20)32-15-10-6-9-13-19(27)31-2/h4-5,7-8,11-12,18,20-24H,1,6,9-10,13-16H2,2-3H3,(H,26,28) |
| InChIKey | YZIGUQVZBODXCZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|