C19H19Cl3F3NO8S — CID 139345702
[(4aR,6S,7R,8S,8aR)-2-phenyl-6-prop-2-enoxy-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate (PubChem CID 139345702) has the molecular formula C19H19Cl3F3NO8S and a molecular weight of 584.78 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-2-phenyl-6-prop-2-enoxy-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-2-phenyl-6-prop-2-enoxy-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139345702 |
| Molecular Formula | C19H19Cl3F3NO8S |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 582.98 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-2-phenyl-6-prop-2-enoxy-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
| SMILES | C=CCO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H19Cl3F3NO8S/c1-2-8-30-16-12(26-17(27)18(20,21)22)14(34-35(28,29)19(23,24)25)13-11(32-16)9-31-15(33-13)10-6-4-3-5-7-10/h2-7,11-16H,1,8-9H2,(H,26,27)/t11-,12-,13-,14+,15?,16+/m1/s1 |
| InChIKey | JADWDYBAZPXNGV-BFTFSUECSA-N |
| XLogP | 3.12 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|