C18H19Cl3N4O5 — CID 139345645
N-[(4aR,6S,7R,8R,8aS)-8-azido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide (PubChem CID 139345645) has the molecular formula C18H19Cl3N4O5 and a molecular weight of 477.73 g/mol. Its IUPAC name is N-[(4aR,6S,7R,8R,8aS)-8-azido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(4aR,6S,7R,8R,8aS)-8-azido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 139345645 |
| Molecular Formula | C18H19Cl3N4O5 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | N-[(4aR,6S,7R,8R,8aS)-8-azido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trichloroacetamide |
| SMILES | C=CCO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](N=[N+]=[N-])[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H19Cl3N4O5/c1-2-8-27-16-13(23-17(26)18(19,20)21)12(24-25-22)14-11(29-16)9-28-15(30-14)10-6-4-3-5-7-10/h2-7,11-16H,1,8-9H2,(H,23,26)/t11-,12-,13-,14-,15?,16+/m1/s1 |
| InChIKey | DVOBHWIVQHAISE-ULFACSLRSA-N |
| XLogP | 3.56 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|