C20H18N6O5 — CID 51055879
[(4aR,6R,7S,8R,8aS)-7,8-diazido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate (PubChem CID 51055879) has the molecular formula C20H18N6O5 and a molecular weight of 422.40 g/mol. Its IUPAC name is [(4aR,6R,7S,8R,8aS)-7,8-diazido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate.
| Compound Name | [(4aR,6R,7S,8R,8aS)-7,8-diazido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate |
|---|---|
| PubChem CID | 51055879 |
| Molecular Formula | C20H18N6O5 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [(4aR,6R,7S,8R,8aS)-7,8-diazido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](OC(=O)c2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C20H18N6O5/c21-25-23-15-16(24-26-22)20(31-18(27)12-7-3-1-4-8-12)29-14-11-28-19(30-17(14)15)13-9-5-2-6-10-13/h1-10,14-17,19-20H,11H2/t14-,15-,16+,17-,19?,20-/m1/s1 |
| InChIKey | WMSOHAHRYBEULU-ONLUYXPGSA-N |
| XLogP | 4.04 |
| TPSA | 151.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|