C27H33N3O7Si — CID 140765703
[(7S,8R,8aS)-7-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-oxo-2-phenylacetate (PubChem CID 140765703) has the molecular formula C27H33N3O7Si and a molecular weight of 539.66 g/mol. Its IUPAC name is [(7S,8R,8aS)-7-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-oxo-2-phenylacetate.
| Compound Name | [(7S,8R,8aS)-7-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 140765703 |
| Molecular Formula | C27H33N3O7Si |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | [(7S,8R,8aS)-7-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-oxo-2-phenylacetate |
| SMILES | CC(C)(C)[Si](C)(C)OC1OC2COC(c3ccccc3)O[C@H]2[C@H](OC(=O)C(=O)c2ccccc2)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C27H33N3O7Si/c1-27(2,3)38(4,5)37-26-20(29-30-28)23(35-24(32)21(31)17-12-8-6-9-13-17)22-19(34-26)16-33-25(36-22)18-14-10-7-11-15-18/h6-15,19-20,22-23,25-26H,16H2,1-5H3/t19?,20-,22+,23+,25?,26?/m0/s1 |
| InChIKey | DRGYPTQTFOYKJH-YWAQEPIKSA-N |
| XLogP | 5.32 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|