C21H18F3N3O8S — CID 11670967
[(2R,4aR,6S,7R,8R,8aR)-7-azido-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate (PubChem CID 11670967) has the molecular formula C21H18F3N3O8S and a molecular weight of 529.45 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aR)-7-azido-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aR)-7-azido-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate |
|---|---|
| PubChem CID | 11670967 |
| Molecular Formula | C21H18F3N3O8S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aR)-7-azido-2-phenyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](OC(=O)c2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O8S/c22-21(23,24)36(29,30)35-17-15(26-27-25)20(34-18(28)12-7-3-1-4-8-12)32-14-11-31-19(33-16(14)17)13-9-5-2-6-10-13/h1-10,14-17,19-20H,11H2/t14-,15-,16-,17-,19-,20+/m1/s1 |
| InChIKey | XKHPLHVMLZYRBY-HZLBELHRSA-N |
| XLogP | 3.60 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|