C26H34O7Si — CID 101266961
[(4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 101266961) has the molecular formula C26H34O7Si and a molecular weight of 486.64 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 101266961 |
| Molecular Formula | C26H34O7Si |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@@H](O)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C26H34O7Si/c1-26(2,3)34(4,5)33-21-20-19(16-29-25(32-20)18-14-10-7-11-15-18)30-24(28)22(21)31-23(27)17-12-8-6-9-13-17/h6-15,19-22,24-25,28H,16H2,1-5H3/t19-,20-,21+,22-,24+,25?/m1/s1 |
| InChIKey | VCGYIOCMAXJMAU-OYYHWXIMSA-N |
| XLogP | 4.43 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|