C25H40O7Si — CID 102377692
[(2R,4aS,6R,7S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate (PubChem CID 102377692) has the molecular formula C25H40O7Si and a molecular weight of 480.67 g/mol. Its IUPAC name is [(2R,4aS,6R,7S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,4aS,6R,7S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102377692 |
| Molecular Formula | C25H40O7Si |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | [(2R,4aS,6R,7S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[C@H](c3ccccc3)OC[C@@H]2O[C@@H]1CO |
| InChI | InChI=1S/C25H40O7Si/c1-24(2,3)23(27)31-19-17(14-26)29-18-15-28-22(16-12-10-9-11-13-16)30-20(18)21(19)32-33(7,8)25(4,5)6/h9-13,17-22,26H,14-15H2,1-8H3/t17-,18+,19+,20+,21+,22-/m1/s1 |
| InChIKey | ICDVEFKQEZMMHZ-VEYVBMQYSA-N |
| XLogP | 4.21 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|