C20H32O5Si — CID 157295900
(6S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 157295900) has the molecular formula C20H32O5Si and a molecular weight of 380.56 g/mol. Its IUPAC name is (6S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 157295900 |
| Molecular Formula | C20H32O5Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (6S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | C[C@@H]1OC2COC(c3ccccc3)O[C@H]2[C@H](O)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O5Si/c1-13-17(25-26(5,6)20(2,3)4)16(21)18-15(23-13)12-22-19(24-18)14-10-8-7-9-11-14/h7-11,13,15-19,21H,12H2,1-6H3/t13-,15?,16+,17?,18+,19?/m0/s1 |
| InChIKey | JJFHAQPDZGDISF-RKSFIYRDSA-N |
| XLogP | 3.64 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|