C19H32O5Si2 — CID 14522199
(2S,4aR,6R,7R,8S,8aR)-2-phenyl-6-trimethylsilyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 14522199) has the molecular formula C19H32O5Si2 and a molecular weight of 396.63 g/mol. Its IUPAC name is (2S,4aR,6R,7R,8S,8aR)-2-phenyl-6-trimethylsilyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2S,4aR,6R,7R,8S,8aR)-2-phenyl-6-trimethylsilyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 14522199 |
| Molecular Formula | C19H32O5Si2 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2S,4aR,6R,7R,8S,8aR)-2-phenyl-6-trimethylsilyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H]2O[C@@H](c3ccccc3)OC[C@H]2O[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C19H32O5Si2/c1-25(2,3)19-17(24-26(4,5)6)15(20)16-14(22-19)12-21-18(23-16)13-10-8-7-9-11-13/h7-11,14-20H,12H2,1-6H3/t14-,15+,16+,17-,18+,19-/m1/s1 |
| InChIKey | AMVNNBZXBGWTHG-BPCAWRKVSA-N |
| XLogP | 3.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|