C25H44O6Si2 — CID 11283362
(2R,4aR,6S,7R,8S,8aR)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-ol (PubChem CID 11283362) has the molecular formula C25H44O6Si2 and a molecular weight of 496.79 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8S,8aR)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-ol.
| Compound Name | (2R,4aR,6S,7R,8S,8aR)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-ol |
|---|---|
| PubChem CID | 11283362 |
| Molecular Formula | C25H44O6Si2 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (2R,4aR,6S,7R,8S,8aR)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C25H44O6Si2/c1-24(2,3)32(7,8)30-20-19-18(16-27-23(29-19)17-14-12-11-13-15-17)28-22(26)21(20)31-33(9,10)25(4,5)6/h11-15,18-23,26H,16H2,1-10H3/t18-,19-,20+,21-,22+,23-/m1/s1 |
| InChIKey | XFRXHMXHVRCCOU-IROFBDHCSA-N |
| XLogP | 5.60 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|