C21H31NO6Si — CID 134971356
N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-5-[(4R)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetamide (PubChem CID 134971356) has the molecular formula C21H31NO6Si and a molecular weight of 421.57 g/mol. Its IUPAC name is N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-5-[(4R)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetamide.
| Compound Name | N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-5-[(4R)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 134971356 |
| Molecular Formula | C21H31NO6Si |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-oxo-5-[(4R)-2-phenyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(=O)OC([C@H]2COC(c3ccccc3)O2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H31NO6Si/c1-13(23)22-16-18(28-29(5,6)21(2,3)4)17(27-19(16)24)15-12-25-20(26-15)14-10-8-7-9-11-14/h7-11,15-18,20H,12H2,1-6H3,(H,22,23)/t15-,16+,17?,18-,20?/m1/s1 |
| InChIKey | FUEYCJLHFAHHFD-SHIAMNQESA-N |
| XLogP | 2.92 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|