C25H39NO7Si — CID 101220297
N-[(4aR,6R,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[(2R)-2-methyloxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 101220297) has the molecular formula C25H39NO7Si and a molecular weight of 493.67 g/mol. Its IUPAC name is N-[(4aR,6R,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[(2R)-2-methyloxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(4aR,6R,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[(2R)-2-methyloxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 101220297 |
| Molecular Formula | C25H39NO7Si |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-[(4aR,6R,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[(2R)-2-methyloxiran-2-yl]methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](OC[C@@]2(C)CO2)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39NO7Si/c1-16(27)26-19-21(33-34(6,7)24(2,3)4)20-18(31-23(19)29-14-25(5)15-30-25)13-28-22(32-20)17-11-9-8-10-12-17/h8-12,18-23H,13-15H2,1-7H3,(H,26,27)/t18-,19-,20-,21-,22?,23-,25+/m1/s1 |
| InChIKey | KFONYHDIZLSVAO-RSAASVIVSA-N |
| XLogP | 3.53 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|