C19H25NO8S — CID 10432661
[(4aR,6R,7R,8R,8aR)-7-acetamido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate (PubChem CID 10432661) has the molecular formula C19H25NO8S and a molecular weight of 427.48 g/mol. Its IUPAC name is [(4aR,6R,7R,8R,8aR)-7-acetamido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate.
| Compound Name | [(4aR,6R,7R,8R,8aR)-7-acetamido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
|---|---|
| PubChem CID | 10432661 |
| Molecular Formula | C19H25NO8S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [(4aR,6R,7R,8R,8aR)-7-acetamido-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
| SMILES | C=CCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OS(C)(=O)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C19H25NO8S/c1-4-10-24-19-15(20-12(2)21)17(28-29(3,22)23)16-14(26-19)11-25-18(27-16)13-8-6-5-7-9-13/h4-9,14-19H,1,10-11H2,2-3H3,(H,20,21)/t14-,15-,16-,17-,18?,19-/m1/s1 |
| InChIKey | BFKPFUIVLNWQFN-HIQCEYAYSA-N |
| XLogP | 0.88 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|