C25H33NO9 — CID 58183822
prop-2-enyl 3-[[(6R,8R,8aR)-7-acetamido-2-phenyl-8-propanoyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-methylpropanoate (PubChem CID 58183822) has the molecular formula C25H33NO9 and a molecular weight of 491.54 g/mol. Its IUPAC name is prop-2-enyl 3-[[(6R,8R,8aR)-7-acetamido-2-phenyl-8-propanoyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-methylpropanoate.
| Compound Name | prop-2-enyl 3-[[(6R,8R,8aR)-7-acetamido-2-phenyl-8-propanoyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 58183822 |
| Molecular Formula | C25H33NO9 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | prop-2-enyl 3-[[(6R,8R,8aR)-7-acetamido-2-phenyl-8-propanoyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-methylpropanoate |
| SMILES | C=CCOC(=O)C(C)CO[C@@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](OC(=O)CC)C1NC(C)=O |
| InChI | InChI=1S/C25H33NO9/c1-5-12-30-23(29)15(3)13-31-25-20(26-16(4)27)22(34-19(28)6-2)21-18(33-25)14-32-24(35-21)17-10-8-7-9-11-17/h5,7-11,15,18,20-22,24-25H,1,6,12-14H2,2-4H3,(H,26,27)/t15?,18?,20?,21-,22+,24?,25+/m0/s1 |
| InChIKey | AJZQSHGYHIMRFV-BSJITRSSSA-N |
| XLogP | 2.03 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|