C32H35NO8 — CID 54288087
benzyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate (PubChem CID 54288087) has the molecular formula C32H35NO8 and a molecular weight of 561.63 g/mol. Its IUPAC name is benzyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate.
| Compound Name | benzyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate |
|---|---|
| PubChem CID | 54288087 |
| Molecular Formula | C32H35NO8 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | benzyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1OC(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H35NO8/c1-21(30(35)36-18-23-12-6-3-7-13-23)39-29-27(33-22(2)34)32(37-19-24-14-8-4-9-15-24)40-26-20-38-31(41-28(26)29)25-16-10-5-11-17-25/h3-17,21,26-29,31-32H,18-20H2,1-2H3,(H,33,34)/t21?,26-,27-,28-,29-,31-,32+/m1/s1 |
| InChIKey | RVOTYDLBSAWUEG-ODYJULNOSA-N |
| XLogP | 4.06 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |