C32H35NO8 — CID 124761625
benzyl 3-[[(2S,4aR,6R,7S,8S,8aR)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate (PubChem CID 124761625) has the molecular formula C32H35NO8 and a molecular weight of 561.63 g/mol. Its IUPAC name is benzyl 3-[[(2S,4aR,6R,7S,8S,8aR)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate.
| Compound Name | benzyl 3-[[(2S,4aR,6R,7S,8S,8aR)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate |
|---|---|
| PubChem CID | 124761625 |
| Molecular Formula | C32H35NO8 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | benzyl 3-[[(2S,4aR,6R,7S,8S,8aR)-7-acetamido-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate |
| SMILES | CC(=O)N[C@@H]1[C@H](OCc2ccccc2)O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H]1OCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H35NO8/c1-22(34)33-28-30(36-18-17-27(35)37-19-23-11-5-2-6-12-23)29-26(21-39-31(41-29)25-15-9-4-10-16-25)40-32(28)38-20-24-13-7-3-8-14-24/h2-16,26,28-32H,17-21H2,1H3,(H,33,34)/t26-,28+,29+,30+,31+,32-/m1/s1 |
| InChIKey | KEPTYWVNHOROCK-TXZHHXPLSA-N |
| XLogP | 4.07 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |