C16H21NO6 — CID 45039740
N-[(6R,7S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 45039740) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[(6R,7S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(6R,7S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 45039740 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[(6R,7S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CO[C@@H]1OC2COC(c3ccccc3)O[C@H]2C(O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C16H21NO6/c1-9(18)17-12-13(19)14-11(22-16(12)20-2)8-21-15(23-14)10-6-4-3-5-7-10/h3-7,11-16,19H,8H2,1-2H3,(H,17,18)/t11?,12-,13?,14+,15?,16+/m0/s1 |
| InChIKey | XCDVOAZVARITEI-RPPAMMDFSA-N |
| XLogP | 0.34 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |