C24H34O5Si — CID 101220698
tert-butyl-dimethyl-[[(1S,3R,6R,8R,10S)-12-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-9-yl]oxy]silane (PubChem CID 101220698) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,3R,6R,8R,10S)-12-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-9-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,3R,6R,8R,10S)-12-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-9-yl]oxy]silane |
|---|---|
| PubChem CID | 101220698 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,3R,6R,8R,10S)-12-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-9-yl]oxy]silane |
| SMILES | C=C1C=CC[C@@H]2O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3C(O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C24H34O5Si/c1-16-11-10-14-18-20(26-16)22(29-30(5,6)24(2,3)4)21-19(27-18)15-25-23(28-21)17-12-8-7-9-13-17/h7-13,18-23H,1,14-15H2,2-6H3/t18-,19+,20-,21+,22?,23+/m0/s1 |
| InChIKey | NGRVMFSEKSRCHH-WUIYMGGXSA-N |
| XLogP | 5.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|