C20H20O5 — CID 15481441
(1R,2R,4R,7S,9R,12R)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,7]tridecane (PubChem CID 15481441) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1R,2R,4R,7S,9R,12R)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (1R,2R,4R,7S,9R,12R)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 15481441 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1R,2R,4R,7S,9R,12R)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,7]tridecane |
| SMILES | c1ccc([C@@H]2OC[C@@H]3O[C@@H]4CO[C@@H](c5ccccc5)O[C@H]4[C@@H]3O2)cc1 |
| InChI | InChI=1S/C20H20O5/c1-3-7-13(8-4-1)19-21-11-15-17(24-19)18-16(23-15)12-22-20(25-18)14-9-5-2-6-10-14/h1-10,15-20H,11-12H2/t15-,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | JBFCVEQMJHLWBQ-DNDRQTMDSA-N |
| XLogP | 2.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |