C21H22O6 — CID 23252784
(4R,4aR,6R,8aS)-6-phenyl-4-[(4R)-2-phenyl-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine (PubChem CID 23252784) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (4R,4aR,6R,8aS)-6-phenyl-4-[(4R)-2-phenyl-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine.
| Compound Name | (4R,4aR,6R,8aS)-6-phenyl-4-[(4R)-2-phenyl-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
|---|---|
| PubChem CID | 23252784 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (4R,4aR,6R,8aS)-6-phenyl-4-[(4R)-2-phenyl-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
| SMILES | c1ccc(C2OC[C@H]([C@H]3OCO[C@H]4CO[C@@H](c5ccccc5)O[C@@H]34)O2)cc1 |
| InChI | InChI=1S/C21H22O6/c1-3-7-14(8-4-1)20-23-12-17(26-20)18-19-16(24-13-25-18)11-22-21(27-19)15-9-5-2-6-10-15/h1-10,16-21H,11-13H2/t16-,17+,18+,19+,20?,21+/m0/s1 |
| InChIKey | BFGDVJQUEUQPNJ-QPUJYEMXSA-N |
| XLogP | 2.96 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |