C14H16O4 — CID 118103900
(2R,4R,5R,7R,10R)-5-methyl-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane (PubChem CID 118103900) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2R,4R,5R,7R,10R)-5-methyl-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane.
| Compound Name | (2R,4R,5R,7R,10R)-5-methyl-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane |
|---|---|
| PubChem CID | 118103900 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (2R,4R,5R,7R,10R)-5-methyl-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane |
| SMILES | C[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)OC2[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C14H16O4/c1-8-11-13(17-11)12-10(16-8)7-15-14(18-12)9-5-3-2-4-6-9/h2-6,8,10-14H,7H2,1H3/t8-,10-,11-,12?,13-,14-/m1/s1 |
| InChIKey | ZIBASRRAIZIKNB-CIDLXXAASA-N |
| XLogP | 1.66 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|