C22H24O5 — CID 58607175
(1S,7S)-4,7-dimethyl-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 58607175) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (1S,7S)-4,7-dimethyl-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1S,7S)-4,7-dimethyl-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 58607175 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (1S,7S)-4,7-dimethyl-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | C[C@@H]1OC2COC(c3ccccc3)O[C@@H]2C2OC(C)(c3ccccc3)OC21 |
| InChI | InChI=1S/C22H24O5/c1-14-18-20(27-22(2,26-18)16-11-7-4-8-12-16)19-17(24-14)13-23-21(25-19)15-9-5-3-6-10-15/h3-12,14,17-21H,13H2,1-2H3/t14-,17?,18?,19-,20?,21?,22?/m0/s1 |
| InChIKey | FNLCWXYFIXLCDY-JFHKFHTKSA-N |
| XLogP | 3.54 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |