C20H28O8 — CID 132917532
(1S,2S,4R,7R,9S,10R,12R,13R)-9,12,13-trimethoxy-12,13-dimethyl-4-phenyl-3,5,8,11,14-pentaoxatricyclo[8.4.0.02,7]tetradecane (PubChem CID 132917532) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is (1S,2S,4R,7R,9S,10R,12R,13R)-9,12,13-trimethoxy-12,13-dimethyl-4-phenyl-3,5,8,11,14-pentaoxatricyclo[8.4.0.02,7]tetradecane.
| Compound Name | (1S,2S,4R,7R,9S,10R,12R,13R)-9,12,13-trimethoxy-12,13-dimethyl-4-phenyl-3,5,8,11,14-pentaoxatricyclo[8.4.0.02,7]tetradecane |
|---|---|
| PubChem CID | 132917532 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (1S,2S,4R,7R,9S,10R,12R,13R)-9,12,13-trimethoxy-12,13-dimethyl-4-phenyl-3,5,8,11,14-pentaoxatricyclo[8.4.0.02,7]tetradecane |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]2[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@@H]12 |
| InChI | InChI=1S/C20H28O8/c1-19(22-4)20(2,23-5)28-16-15(27-19)14-13(25-18(16)21-3)11-24-17(26-14)12-9-7-6-8-10-12/h6-10,13-18H,11H2,1-5H3/t13-,14+,15+,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | XFPLPJKREQUDEE-OHOCTDEJSA-N |
| XLogP | 1.98 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |