C15H16O7 — CID 102519122
(1R,2S,6R,7R,9R)-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 102519122) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is (1R,2S,6R,7R,9R)-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1R,2S,6R,7R,9R)-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 102519122 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (1R,2S,6R,7R,9R)-7-methoxy-12-phenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | CO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(=O)O[C@@H]12 |
| InChI | InChI=1S/C15H16O7/c1-17-14-12-11(21-15(16)22-12)10-9(19-14)7-18-13(20-10)8-5-3-2-4-6-8/h2-6,9-14H,7H2,1H3/t9-,10-,11+,12-,13?,14-/m1/s1 |
| InChIKey | IBJWEQZTDVKKGQ-ZGIFUDTASA-N |
| XLogP | 1.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |