C23H24O7 — CID 135022537
(14S)-9-methoxy-4,14-diphenyl-3,5,8,11,15-pentaoxatricyclo[8.5.0.02,7]pentadecan-12-one (PubChem CID 135022537) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is (14S)-9-methoxy-4,14-diphenyl-3,5,8,11,15-pentaoxatricyclo[8.5.0.02,7]pentadecan-12-one.
| Compound Name | (14S)-9-methoxy-4,14-diphenyl-3,5,8,11,15-pentaoxatricyclo[8.5.0.02,7]pentadecan-12-one |
|---|---|
| PubChem CID | 135022537 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (14S)-9-methoxy-4,14-diphenyl-3,5,8,11,15-pentaoxatricyclo[8.5.0.02,7]pentadecan-12-one |
| SMILES | COC1OC2COC(c3ccccc3)OC2C2O[C@H](c3ccccc3)CC(=O)OC12 |
| InChI | InChI=1S/C23H24O7/c1-25-23-21-20(27-16(12-18(24)29-21)14-8-4-2-5-9-14)19-17(28-23)13-26-22(30-19)15-10-6-3-7-11-15/h2-11,16-17,19-23H,12-13H2,1H3/t16-,17?,19?,20?,21?,22?,23?/m0/s1 |
| InChIKey | ACSPDOAJVYFSCG-QETPRIGXSA-N |
| XLogP | 2.91 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |