C19H20O6 — CID 20701635
(2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)methanediol (PubChem CID 20701635) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)methanediol.
| Compound Name | (2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)methanediol |
|---|---|
| PubChem CID | 20701635 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)methanediol |
| SMILES | OC(O)C1OC(c2ccccc2)OC2COC(c3ccccc3)OC21 |
| InChI | InChI=1S/C19H20O6/c20-17(21)16-15-14(23-19(25-16)13-9-5-2-6-10-13)11-22-18(24-15)12-7-3-1-4-8-12/h1-10,14-21H,11H2 |
| InChIKey | WCISSESMBICPJQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|