C22H24O7 — CID 12881837
ethyl (2S)-2-[(4R,4aR,8aS)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxyacetate (PubChem CID 12881837) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is ethyl (2S)-2-[(4R,4aR,8aS)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxyacetate.
| Compound Name | ethyl (2S)-2-[(4R,4aR,8aS)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 12881837 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl (2S)-2-[(4R,4aR,8aS)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxyacetate |
| SMILES | CCOC(=O)[C@@H](O)[C@H]1OC(c2ccccc2)O[C@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C22H24O7/c1-2-25-20(24)17(23)19-18-16(27-22(29-19)15-11-7-4-8-12-15)13-26-21(28-18)14-9-5-3-6-10-14/h3-12,16-19,21-23H,2,13H2,1H3/t16-,17-,18+,19+,21?,22?/m0/s1 |
| InChIKey | SAGCELDQIWJBAY-AFALJTEMSA-N |
| XLogP | 2.51 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |