C20H24O6 — CID 143658402
1-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol (PubChem CID 143658402) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol.
| Compound Name | 1-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 143658402 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol |
| SMILES | OCC(O)C1OC(C2=CCCC=C2)OC2COC(c3ccccc3)OC21 |
| InChI | InChI=1S/C20H24O6/c21-11-15(22)17-18-16(24-20(25-17)14-9-5-2-6-10-14)12-23-19(26-18)13-7-3-1-4-8-13/h1,3-5,7-10,15-22H,2,6,11-12H2 |
| InChIKey | QDJJJZDLRJDZLH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |