C20H26O6 — CID 142076654
1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol (PubChem CID 142076654) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 142076654 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
| SMILES | C/C=C\C(=C/C)C1OC2COC(c3ccccc3)OC2C(C(O)CO)O1 |
| InChI | InChI=1S/C20H26O6/c1-3-8-13(4-2)20-24-16-12-23-19(14-9-6-5-7-10-14)26-18(16)17(25-20)15(22)11-21/h3-10,15-22H,11-12H2,1-2H3/b8-3-,13-4+ |
| InChIKey | JXCJCMBSOQINMV-FDHJNFDVSA-N |
| XLogP | 2.09 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|