C20H21FO6 — CID 23557643
(1R)-1-[(4R,4aR,8aS)-6-(4-fluorophenyl)-2-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol (PubChem CID 23557643) has the molecular formula C20H21FO6 and a molecular weight of 376.38 g/mol. Its IUPAC name is (1R)-1-[(4R,4aR,8aS)-6-(4-fluorophenyl)-2-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(4R,4aR,8aS)-6-(4-fluorophenyl)-2-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 23557643 |
| Molecular Formula | C20H21FO6 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (1R)-1-[(4R,4aR,8aS)-6-(4-fluorophenyl)-2-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H]1OC(c2ccccc2)O[C@H]2COC(c3ccc(F)cc3)O[C@@H]12 |
| InChI | InChI=1S/C20H21FO6/c21-14-8-6-13(7-9-14)19-24-11-16-18(27-19)17(15(23)10-22)26-20(25-16)12-4-2-1-3-5-12/h1-9,15-20,22-23H,10-11H2/t15-,16+,17-,18-,19?,20?/m1/s1 |
| InChIKey | DHUNATKHOZVAGR-VVBFYGJXSA-N |
| XLogP | 2.08 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |