C28H38O5SSi — CID 102349961
[(4aR,6R,7S,8S,8aR)-2-phenyl-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102349961) has the molecular formula C28H38O5SSi and a molecular weight of 514.76 g/mol. Its IUPAC name is [(4aR,6R,7S,8S,8aR)-2-phenyl-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,6R,7S,8S,8aR)-2-phenyl-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102349961 |
| Molecular Formula | C28H38O5SSi |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [(4aR,6R,7S,8S,8aR)-2-phenyl-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCO[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C28H38O5SSi/c1-7-18-29-25-24(33-35(5,6)28(2,3)4)23-22(31-27(25)34-21-16-12-9-13-17-21)19-30-26(32-23)20-14-10-8-11-15-20/h7-17,22-27H,1,18-19H2,2-6H3/t22-,23-,24+,25+,26?,27-/m1/s1 |
| InChIKey | CYRJZZDNHNDPLM-GWTRWCDOSA-N |
| XLogP | 6.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|