C21H34O4Si — CID 157142781
[(6R,8S,8aS)-6,8-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 157142781) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is [(6R,8S,8aS)-6,8-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(6R,8S,8aS)-6,8-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 157142781 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [(6R,8S,8aS)-6,8-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1C(O[Si](C)(C)C(C)(C)C)[C@@H](C)OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C21H34O4Si/c1-14-18(25-26(6,7)21(3,4)5)15(2)23-17-13-22-20(24-19(14)17)16-11-9-8-10-12-16/h8-12,14-15,17-20H,13H2,1-7H3/t14-,15-,17?,18?,19+,20?/m1/s1 |
| InChIKey | AKJJIQOKPJRCAV-CEYACPIQSA-N |
| XLogP | 4.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|