C37H40O6SSi — CID 58679015
[(6S,8S,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 58679015) has the molecular formula C37H40O6SSi and a molecular weight of 640.87 g/mol. Its IUPAC name is [(6S,8S,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(6S,8S,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 58679015 |
| Molecular Formula | C37H40O6SSi |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | [(6S,8S,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CS[C@@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H40O6SSi/c1-37(2,3)45(28-21-13-7-14-22-28,29-23-15-8-16-24-29)43-32-31-30(25-39-35(42-31)27-19-11-6-12-20-27)40-36(44-4)33(32)41-34(38)26-17-9-5-10-18-26/h5-24,30-33,35-36H,25H2,1-4H3/t30?,31-,32-,33?,35?,36-/m0/s1 |
| InChIKey | IDWOXUAGCYZJMX-FOADNVHDSA-N |
| XLogP | 6.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|