C26H28O8S — CID 15281742
[(4aR,6S,7R,8S,8aS)-6-methylsulfanyl-8-(4-oxopentanoyloxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 15281742) has the molecular formula C26H28O8S and a molecular weight of 500.57 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aS)-6-methylsulfanyl-8-(4-oxopentanoyloxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(4aR,6S,7R,8S,8aS)-6-methylsulfanyl-8-(4-oxopentanoyloxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 15281742 |
| Molecular Formula | C26H28O8S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | [(4aR,6S,7R,8S,8aS)-6-methylsulfanyl-8-(4-oxopentanoyloxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CS[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](OC(=O)CCC(C)=O)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28O8S/c1-16(27)13-14-20(28)32-22-21-19(15-30-25(34-21)18-11-7-4-8-12-18)31-26(35-2)23(22)33-24(29)17-9-5-3-6-10-17/h3-12,19,21-23,25-26H,13-15H2,1-2H3/t19-,21+,22+,23-,25?,26+/m1/s1 |
| InChIKey | UQTZDYAYVMGQJT-VTERETGXSA-N |
| XLogP | 3.70 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |