C28H24O7 — CID 23241574
[(1S,2S,4S,5S,6S,7R,9R)-5-benzoyloxy-9-phenyl-3,8,10-trioxatricyclo[5.4.0.02,4]undecan-6-yl] benzoate (PubChem CID 23241574) has the molecular formula C28H24O7 and a molecular weight of 472.49 g/mol. Its IUPAC name is [(1S,2S,4S,5S,6S,7R,9R)-5-benzoyloxy-9-phenyl-3,8,10-trioxatricyclo[5.4.0.02,4]undecan-6-yl] benzoate.
| Compound Name | [(1S,2S,4S,5S,6S,7R,9R)-5-benzoyloxy-9-phenyl-3,8,10-trioxatricyclo[5.4.0.02,4]undecan-6-yl] benzoate |
|---|---|
| PubChem CID | 23241574 |
| Molecular Formula | C28H24O7 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [(1S,2S,4S,5S,6S,7R,9R)-5-benzoyloxy-9-phenyl-3,8,10-trioxatricyclo[5.4.0.02,4]undecan-6-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2[C@@H]2O[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C28H24O7/c29-26(17-10-4-1-5-11-17)33-24-22-20(16-31-28(35-22)19-14-8-3-9-15-19)21-23(32-21)25(24)34-27(30)18-12-6-2-7-13-18/h1-15,20-25,28H,16H2/t20-,21-,22+,23-,24-,25-,28+/m0/s1 |
| InChIKey | IVRKDOBLQINWGY-KVPPFYHMSA-N |
| XLogP | 3.95 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|