C27H28O9 — CID 88547572
[(6S,8S,8aS)-8-methyl-2-phenyl-6-[[(2R,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 88547572) has the molecular formula C27H28O9 and a molecular weight of 496.51 g/mol. Its IUPAC name is [(6S,8S,8aS)-8-methyl-2-phenyl-6-[[(2R,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(6S,8S,8aS)-8-methyl-2-phenyl-6-[[(2R,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 88547572 |
| Molecular Formula | C27H28O9 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [(6S,8S,8aS)-8-methyl-2-phenyl-6-[[(2R,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | C[C@@H]1C(OC(=O)c2ccccc2)[C@H](O[C@H]2C3O[C@H]3C3OC[C@H]2O3)OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C27H28O9/c1-14-19-17(12-29-25(35-19)16-10-6-3-7-11-16)32-27(20(14)34-24(28)15-8-4-2-5-9-15)36-21-18-13-30-26(31-18)23-22(21)33-23/h2-11,14,17-23,25-27H,12-13H2,1H3/t14-,17?,18+,19-,20?,21+,22?,23+,25?,26?,27-/m0/s1 |
| InChIKey | GEZXURBZTLKVKZ-REXJKTNGSA-N |
| XLogP | 2.59 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|