C29H39O9P — CID 118667262
[(8S,8aS)-6-dibutoxyphosphoryloxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 118667262) has the molecular formula C29H39O9P and a molecular weight of 562.60 g/mol. Its IUPAC name is [(8S,8aS)-6-dibutoxyphosphoryloxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(8S,8aS)-6-dibutoxyphosphoryloxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 118667262 |
| Molecular Formula | C29H39O9P |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | [(8S,8aS)-6-dibutoxyphosphoryloxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CCCCOP(=O)(OCCCC)OC1OC2COC(c3ccccc3)O[C@H]2[C@H](C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H39O9P/c1-4-6-18-33-39(31,34-19-7-5-2)38-29-26(36-27(30)22-14-10-8-11-15-22)21(3)25-24(35-29)20-32-28(37-25)23-16-12-9-13-17-23/h8-17,21,24-26,28-29H,4-7,18-20H2,1-3H3/t21-,24?,25-,26?,28?,29?/m0/s1 |
| InChIKey | XXBPHOHNLHHDTA-CKIMTFNISA-N |
| XLogP | 6.45 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|