C35H38O5S — CID 91135296
[(6S,8S,8aS)-6-ethylsulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate;2-ethylnaphthalene (PubChem CID 91135296) has the molecular formula C35H38O5S and a molecular weight of 570.75 g/mol. Its IUPAC name is [(6S,8S,8aS)-6-ethylsulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate;2-ethylnaphthalene.
| Compound Name | [(6S,8S,8aS)-6-ethylsulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate;2-ethylnaphthalene |
|---|---|
| PubChem CID | 91135296 |
| Molecular Formula | C35H38O5S |
| Molecular Weight | 570.75 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [(6S,8S,8aS)-6-ethylsulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate;2-ethylnaphthalene |
| SMILES | CCS[C@@H]1OC2COC(c3ccccc3)O[C@H]2[C@H](C)C1OC(=O)c1ccccc1.CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H26O5S.C12H12/c1-3-29-23-20(27-21(24)16-10-6-4-7-11-16)15(2)19-18(26-23)14-25-22(28-19)17-12-8-5-9-13-17;1-2-10-7-8-11-5-3-4-6-12(11)9-10/h4-13,15,18-20,22-23H,3,14H2,1-2H3;3-9H,2H2,1H3/t15-,18?,19-,20?,22?,23-;/m0./s1 |
| InChIKey | RQXXMKRJRXYNSM-QGSXNGJYSA-N |
| XLogP | 7.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |