C33H32O7 — CID 142600842
[(6R,8aS)-6-ethoxy-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 142600842) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is [(6R,8aS)-6-ethoxy-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(6R,8aS)-6-ethoxy-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 142600842 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | [(6R,8aS)-6-ethoxy-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CCO[C@@H]1OC2COC(c3ccccc3)O[C@@H]2C(OCc2ccc3ccccc3c2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H32O7/c1-2-35-33-30(39-31(34)24-12-5-3-6-13-24)29(36-20-22-17-18-23-11-9-10-16-26(23)19-22)28-27(38-33)21-37-32(40-28)25-14-7-4-8-15-25/h3-19,27-30,32-33H,2,20-21H2,1H3/t27?,28-,29?,30?,32?,33+/m0/s1 |
| InChIKey | ZJRZIHFWIUAXAG-RSZNBLEVSA-N |
| XLogP | 5.83 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |