C37H36O5S — CID 121396127
(2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-7,8-bis(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 121396127) has the molecular formula C37H36O5S and a molecular weight of 592.76 g/mol. Its IUPAC name is (2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-7,8-bis(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-7,8-bis(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 121396127 |
| Molecular Formula | C37H36O5S |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | (2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-7,8-bis(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCS[C@@H]1O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H](OCc2ccc3ccccc3c2)[C@H]1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H36O5S/c1-2-43-37-35(39-23-26-17-19-28-11-7-9-15-31(28)21-26)34(38-22-25-16-18-27-10-6-8-14-30(27)20-25)33-32(41-37)24-40-36(42-33)29-12-4-3-5-13-29/h3-21,32-37H,2,22-24H2,1H3/t32-,33+,34+,35-,36+,37+/m1/s1 |
| InChIKey | CXENRNRITGFTIF-SALXNQQMSA-N |
| XLogP | 8.06 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |