C25H28O5S — CID 102491441
(4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-7-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 102491441) has the molecular formula C25H28O5S and a molecular weight of 440.56 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-7-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-7-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 102491441 |
| Molecular Formula | C25H28O5S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-7-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C#CCO[C@@H]1[C@@H](OCc2ccccc2)[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@H]1SCC |
| InChI | InChI=1S/C25H28O5S/c1-3-15-26-23-22(27-16-18-11-7-5-8-12-18)21-20(29-25(23)31-4-2)17-28-24(30-21)19-13-9-6-10-14-19/h1,5-14,20-25H,4,15-17H2,2H3/t20-,21-,22+,23-,24?,25+/m1/s1 |
| InChIKey | AVTJANSNKYRFKV-DQZWSBCQSA-N |
| XLogP | 4.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|